16974-50-8 Usage
Uses
Used in Pharmaceutical Research:
2,4-Dihydrazinopyrimidine is utilized as a chemical compound in pharmaceutical research for its potential biological activity. Its unique structure allows it to be explored for various therapeutic applications, including the development of new drugs and treatments.
Used in Drug Development:
In the field of drug development, 2,4-dihydrazinopyrimidine serves as a key component in the synthesis of novel compounds with potential medicinal properties. Its versatility and reactivity in chemical reactions make it an attractive building block for creating new pharmaceutical agents.
Used in Chemical Synthesis:
2,4-Dihydrazinopyrimidine is employed as a synthetic intermediate in the preparation of various chemical compounds. Its ability to participate in a range of chemical reactions, such as condensation, substitution, and cyclization, makes it a valuable asset in the synthesis of complex organic molecules.
Used in Laboratory Research:
As a compound of interest in the field of chemistry, 2,4-dihydrazinopyrimidine is used in laboratory research to study its properties, reactivity, and potential applications. Researchers investigate its interactions with other molecules, its stability under different conditions, and its potential as a precursor for the synthesis of other compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 16974-50-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,6,9,7 and 4 respectively; the second part has 2 digits, 5 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 16974-50:
(7*1)+(6*6)+(5*9)+(4*7)+(3*4)+(2*5)+(1*0)=138
138 % 10 = 8
So 16974-50-8 is a valid CAS Registry Number.
InChI:InChI=1/C4H8N6/c5-9-3-1-2-7-4(8-3)10-6/h1-2H,5-6H2,(H2,7,8,9,10)
16974-50-8Relevant academic research and scientific papers
Liu, Wei-Min,Zhu, You-Quan,Wang, Yi-Feng,Liu, Bin,Zou, Xiao-Mao,Yang, Hua-Zheng
, p. 967 - 971 (2007)
(Chemical Equation Presented) A series of 2-(3-(trifluoromethyl)-5-(alkoxy) -1H-pyrazol-l-yl)-4-aryloxypyrimidine derivatives were designed and synthesized. The structures of all the title compounds were confirmed by 1H NMR and elementary analy
