169750-95-2 Usage
Uses
Used in Pharmaceutical Industry:
4-Chloro-5-fluoro-2-methylpyridine is used as a key intermediate in the synthesis of various pharmaceuticals. Its unique structure and reactivity make it a valuable component in the development of new drugs with specific therapeutic properties.
Used in Agrochemical Industry:
In the agrochemical sector, 4-Chloro-5-fluoro-2-methylpyridine is employed as an intermediate for the production of agrochemicals, such as pesticides and herbicides. Its incorporation into these compounds can enhance their effectiveness in controlling pests and weeds, thereby improving crop yields and quality.
Used in Organic Synthesis:
4-Chloro-5-fluoro-2-methylpyridine is utilized as a building block in organic synthesis, particularly for the production of complex heterocyclic compounds. Its presence in these compounds can impart unique chemical and biological properties, making them suitable for various applications in the chemical, pharmaceutical, and materials science industries.
Used in Research and Development:
Due to its reactivity and structural features, 4-Chloro-5-fluoro-2-methylpyridine is often used in research and development settings to explore new chemical reactions and synthesize novel compounds with potential applications in various fields, including medicine, agriculture, and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 169750-95-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,6,9,7,5 and 0 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 169750-95:
(8*1)+(7*6)+(6*9)+(5*7)+(4*5)+(3*0)+(2*9)+(1*5)=182
182 % 10 = 2
So 169750-95-2 is a valid CAS Registry Number.
InChI:InChI=1/C6H5ClFN/c1-4-2-5(7)6(8)3-9-4/h2-3H,1H3
