16987-28-3 Usage
Chemical structure
A hexahydro-1H-azepine ring with an attached p-diethylamino benzylidene amino group.
Functional groups
Diethylamino, benzylidene, and amino groups.
Use as a starting material
Often used in the synthesis of other compounds.
Application in coordination chemistry
Can be used as a ligand.
Potential applications
Pharmaceutical research and drug development.
Structural characteristics
Unique arrangement of atoms and functional groups that contribute to its potential pharmacological activities.
Safety precautions
Handle with caution due to possible toxic or hazardous properties.
Laboratory handling
Proper safety measures should be followed when working with this compound in a laboratory setting.
Importance in chemical synthesis
Has significant roles in the creation of various chemical compounds.
Relevance in medicinal chemistry
Its unique structure and properties make it a valuable compound for research and development in the field of medicinal chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 16987-28-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,6,9,8 and 7 respectively; the second part has 2 digits, 2 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 16987-28:
(7*1)+(6*6)+(5*9)+(4*8)+(3*7)+(2*2)+(1*8)=153
153 % 10 = 3
So 16987-28-3 is a valid CAS Registry Number.
InChI:InChI=1/C17H27N3/c1-3-19(4-2)17-11-9-16(10-12-17)15-18-20-13-7-5-6-8-14-20/h9-12,15H,3-8,13-14H2,1-2H3
