170108-05-1 Usage
Uses
Used in Pharmaceutical Industry:
2-Bromo-3,4-difluorobenzoic acid is used as a building block for the synthesis of pharmaceutical compounds due to its unique structure and properties, which can contribute to the development of new drugs with improved therapeutic effects.
Used in Agrochemical Industry:
2-Bromo-3,4-difluorobenzoic acid is used as a precursor in the synthesis of agrochemicals, such as pesticides and herbicides, where its specific chemical properties can enhance the effectiveness of these products.
Used in Materials Science:
2-Bromo-3,4-difluorobenzoic acid is used as a component in the development of new materials with specific properties, such as high thermal stability, chemical resistance, or unique optical characteristics, for various applications in materials science.
Used in Organic Chemistry Research:
2-Bromo-3,4-difluorobenzoic acid is used as a valuable tool in organic chemistry research for the exploration of new synthetic pathways, the study of reaction mechanisms, and the development of innovative methodologies in organic synthesis.
Check Digit Verification of cas no
The CAS Registry Mumber 170108-05-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,0,1,0 and 8 respectively; the second part has 2 digits, 0 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 170108-05:
(8*1)+(7*7)+(6*0)+(5*1)+(4*0)+(3*8)+(2*0)+(1*5)=91
91 % 10 = 1
So 170108-05-1 is a valid CAS Registry Number.
InChI:InChI=1/C7H3BrF2O2/c8-5-3(7(11)12)1-2-4(9)6(5)10/h1-2H,(H,11,12)
