17016-39-6 Usage
Description
2,4,6,8-Decatetraenoic Acid is a chemical compound characterized by its golden to brown powder form. It is known for its unique structure, featuring four double bonds at the 2nd, 4th, 6th, and 8th carbon positions, which contribute to its distinct chemical properties and potential applications.
Uses
Used in Environmental Control:
2,4,6,8-Decatetraenoic Acid plays a crucial role in the environmental control of calicheamicin polyketide synthase, which is capable of detecting programmed octaketide and allows for enediyne biosynthesis. This application is significant in the study and control of certain biological processes and their environmental impact.
Used in Chemical Synthesis:
2,4,6,8-Decatetraenoic Acid serves as a key intermediate in the synthesis of unsaturated colored fatty acids. Its unique structure with multiple double bonds makes it a valuable component in the creation of various specialty chemicals and compounds with specific properties and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 17016-39-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,7,0,1 and 6 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 17016-39:
(7*1)+(6*7)+(5*0)+(4*1)+(3*6)+(2*3)+(1*9)=86
86 % 10 = 6
So 17016-39-6 is a valid CAS Registry Number.
InChI:InChI=1/C10H12O2/c1-2-3-4-5-6-7-8-9-10(11)12/h2-9H,1H3,(H,11,12)/b3-2+,5-4+,7-6+,9-8+
17016-39-6Relevant articles and documents
Direct conversion of polyconjugated compounds into their corresponding carboxylic acids by Acetobacter aceti
Pini, Elena,Bertacche, Vittorio,Molinari, Francesco,Romano, Diego,Gandolfi, Raffaella
, p. 8638 - 8641 (2008/12/21)
The conversion of polyconjugated aldehydes or alcohols into their corresponding acids was carried out using Acetobacter aceti. The analytical results were compared with those of the acids chemically obtained using a Horner-Wittig reaction.