170735-26-9 Usage
General Description
2-(3-Chloro-phenoxy)acetamidine is a chemical compound with the molecular formula C8H9ClN2O. It belongs to the class of organic compounds known as acetamidines, which are organic compounds containing a functional group with the structure R1C(=NR2)NR3R4. The 3-chloro-phenoxy group attached to the acetamidine functional group gives the compound its specific properties and chemical behavior. 2-(3-CHLORO-PHENOXY)ACETAMIDINE may have various industrial and agricultural applications as a building block in the synthesis of other organic compounds or as a potential chemical intermediate in the manufacture of pharmaceuticals or agrochemicals. Its specific uses and properties would depend on the context in which it is applied and the other substances with which it interacts.
Check Digit Verification of cas no
The CAS Registry Mumber 170735-26-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,0,7,3 and 5 respectively; the second part has 2 digits, 2 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 170735-26:
(8*1)+(7*7)+(6*0)+(5*7)+(4*3)+(3*5)+(2*2)+(1*6)=129
129 % 10 = 9
So 170735-26-9 is a valid CAS Registry Number.
InChI:InChI=1/C8H9ClN2O/c9-6-2-1-3-7(4-6)12-5-8(10)11/h1-4H,5H2,(H3,10,11)
170735-26-9Relevant articles and documents
POLY(ADP-RIBOSE) POLYMERASE INHIBITORS CONSISTING OF PYRIMIDINE DERIVATIVES
-
, (2008/06/13)
A medicament for therapeutic and/or preventive treatment of a brain disease, which comprises a compound represented by the following general formula (I) or a pharmaceutically acceptable salt thereof as an active ingredient: wherein R represents hydrogen atom, a C1-C8 alkyl group, a substituted C1-C8 alkyl group, an aryl group, a substituted aryl group, an aryl(C1-C8)alkyl group and the like; Y represents hydrogen atom or -C(R2)R3 (R2 and R3 represent hydrogen atom, a C1-C8 alkyl group, a C1-C8 alkoxy(C1-C8)alkyl group, a hydroxy(C1-C8)alkyl group and the like); symbol "a" represents single bond when Y represents hydrogen atom, or "a" represents double bound when Y represents -C(R2)R3; -A-B- represents -CH2-CH2-, -S-CH2-, -O-CH2-, -CH2-S-, -CH2-O-, -SO-CH2-, -CH2-SO-, -SO2-CH2-, or -CH2-SO2-; and Z represents -CH2- or single bond.
