171204-16-3 Usage
Classification
Quinoline class of chemicals
Belongs to a group of chemical compounds that share a common core structure, the quinoline ring.
3. Quinoline core
The central structure of the compound, which is a tricyclic aromatic ring system.
4. Carboxylic acid substituent at the 4 position
A functional group (-COOH) attached to the quinoline core at the 4th position, contributing to the compound's acidity and solubility.
5. Amino group with a 2-methylphenyl substituent at the 2 position
A nitrogen-containing functional group (-NH2) attached to the quinoline core at the 2nd position, with an additional 2-methylphenyl group providing steric hindrance and electronic effects.
Potential applications
Pharmaceutical industry
The compound may be used as a building block in the synthesis of new drugs due to its unique chemical structure and properties.
Research and development
New materials and technologies
The specific chemical structure and properties of 2-[(2-methylphenyl)amino]quinoline-4-carboxylic acid make it a potential candidate for the development of new materials and technologies in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 171204-16-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,1,2,0 and 4 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 171204-16:
(8*1)+(7*7)+(6*1)+(5*2)+(4*0)+(3*4)+(2*1)+(1*6)=93
93 % 10 = 3
So 171204-16-3 is a valid CAS Registry Number.
InChI:InChI=1/C17H14N2O2/c1-11-6-2-4-8-14(11)18-16-10-13(17(20)21)12-7-3-5-9-15(12)19-16/h2-10H,1H3,(H,18,19)(H,20,21)
