171252-79-2 Usage
Uses
Used in Pharmaceutical Applications:
(S)-2β,8-Dimethyl-3-methylene-1-oxa-8-azaspiro[4.5]decane/(2R,3R)-2,3-dihydroxybutanedioic acid,(1:1) is used as a pharmaceutical compound for its potential therapeutic properties. The combination of the spiro compound and dicarboxylic acid may offer novel mechanisms of action or enhanced efficacy in treating certain medical conditions.
Used in Materials Science:
In the field of materials science, (S)-2β,8-Dimethyl-3-methylene-1-oxa-8-azaspiro[4.5]decane/(2R,3R)-2,3-dihydroxybutanedioic acid,(1:1) is used as a component in the development of new materials. The unique structure of the compound may contribute to the creation of materials with specific properties, such as improved strength, flexibility, or chemical resistance.
Used in Chemical Research:
(S)-2β,8-Dimethyl-3-methylene-1-oxa-8-azaspiro[4.5]decane/(2R,3R)-2,3-dihydroxybutanedioic acid,(1:1) is used as a research compound for studying its chemical properties and potential reactions with other substances. This can lead to the discovery of new chemical processes or the development of new compounds with specific applications.
Used in the Cosmetics Industry:
Used in the Food Industry:
Check Digit Verification of cas no
The CAS Registry Mumber 171252-79-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,1,2,5 and 2 respectively; the second part has 2 digits, 7 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 171252-79:
(8*1)+(7*7)+(6*1)+(5*2)+(4*5)+(3*2)+(2*7)+(1*9)=122
122 % 10 = 2
So 171252-79-2 is a valid CAS Registry Number.
InChI:InChI=1/C11H19NO.C4H6O6/c1-9-8-11(13-10(9)2)4-6-12(3)7-5-11;5-1(3(7)8)2(6)4(9)10/h10H,1,4-8H2,2-3H3;1-2,5-6H,(H,7,8)(H,9,10)/t;1-,2-/m.1/s1
