171408-73-4 Usage
Uses
Used in Pharmaceutical Industry:
2,5-Dibromo-4-Methylpyrimidine is used as a building block for the synthesis of various pharmaceutical drugs. Its unique chemical structure and reactivity make it a valuable intermediate in the development of new drugs with improved therapeutic properties and efficacy.
Used in Agrochemical Industry:
In the agrochemical industry, 2,5-Dibromo-4-Methylpyrimidine is used as a key component in the synthesis of agrochemicals, such as pesticides and herbicides. Its incorporation into these products enhances their effectiveness in controlling pests and weeds, contributing to increased crop yields and agricultural productivity.
Used in Material Science:
2,5-Dibromo-4-Methylpyrimidine is also utilized in the development of new materials, such as polymers and coatings, due to its unique chemical properties. Its incorporation into these materials can improve their performance, durability, and resistance to various environmental factors.
Used in Organic Synthesis:
As a halogenated pyrimidine, 2,5-Dibromo-4-Methylpyrimidine is a versatile intermediate in organic synthesis. It can be used in various chemical reactions, such as nucleophilic substitution, to form a wide range of compounds with diverse applications in various industries.
Safety Precautions:
Due to its halogenated nature, 2,5-Dibromo-4-Methylpyrimidine should be handled with care to avoid potential health hazards and environmental impacts. Proper safety protocols, including the use of personal protective equipment, should be followed during its synthesis, storage, and use. Additionally, disposal methods should be in accordance with local regulations to minimize environmental contamination.
Check Digit Verification of cas no
The CAS Registry Mumber 171408-73-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,1,4,0 and 8 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 171408-73:
(8*1)+(7*7)+(6*1)+(5*4)+(4*0)+(3*8)+(2*7)+(1*3)=124
124 % 10 = 4
So 171408-73-4 is a valid CAS Registry Number.
InChI:InChI=1/C5H4Br2N2/c1-3-4(6)2-8-5(7)9-3/h2H,1H3
171408-73-4Relevant articles and documents
NOVEL COMPOUNDS
-
Page 87-88, (2010/02/09)
The invention relates to substituted phenoxyacetic acids (I) as useful pharmaceutical compounds for treating respiratory disorders, pharmaceutical compositions containing them, and processes for their preparation
