17142-81-3 Usage
Uses
Used in Photochromic Compounds Synthesis:
6-Benzothiazolamine,2-ethyl-(9CI) is used as a key intermediate in the synthesis of photochromic compounds, specifically Spiro(benzothiazolinebenzopyrans). These compounds exhibit the ability to change their color upon exposure to light, making them valuable in various applications such as smart windows, optical data storage, and photoresponsive materials.
Used in Chemical Research:
As a member of the benzothiazole family, 6-Benzothiazolamine,2-ethyl-(9CI) can be utilized in chemical research to explore its properties, reactivity, and potential for further functionalization. This may lead to the development of new compounds with specific applications in various industries, such as pharmaceuticals, materials science, and agrochemicals.
Used in Pharmaceutical Industry:
6-Benzothiazolamine,2-ethyl-(9CI) may also find applications in the pharmaceutical industry as a building block for the development of new drugs. Its unique structure and properties can be exploited to design and synthesize novel therapeutic agents with potential applications in various medical conditions.
Used in Dye and Pigment Industry:
Due to its ability to form photochromic compounds, 6-Benzothiazolamine,2-ethyl-(9CI) can be used in the dye and pigment industry to develop new colorants with unique properties. These dyes and pigments can be employed in various applications, such as in the textile, printing, and painting industries, where color-changing properties can be advantageous.
Used in Material Science:
The photochromic properties of 6-Benzothiazolamine,2-ethyl-(9CI) and its derivatives can also be exploited in material science to develop smart materials with light-responsive characteristics. These materials can be used in various applications, such as sensors, switches, and optical devices, where a change in color or transparency upon exposure to light can be beneficial.
Check Digit Verification of cas no
The CAS Registry Mumber 17142-81-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,7,1,4 and 2 respectively; the second part has 2 digits, 8 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 17142-81:
(7*1)+(6*7)+(5*1)+(4*4)+(3*2)+(2*8)+(1*1)=93
93 % 10 = 3
So 17142-81-3 is a valid CAS Registry Number.
InChI:InChI=1/C9H10N2S/c1-2-9-11-7-4-3-6(10)5-8(7)12-9/h3-5H,2,10H2,1H3