17148-49-1 Usage
Uses
Used in Pharmaceutical Research and Development:
Pyrimidine, 5-fluoro-2-methoxy(8CI,9CI) is employed as a key intermediate in the synthesis of novel drugs and biologically active compounds. Its unique structural features contribute to the development of new therapeutic agents with enhanced efficacy and selectivity.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, Pyrimidine, 5-fluoro-2-methoxy(8CI,9CI) serves as a valuable building block for the design and optimization of drug candidates. Its presence in molecular structures can modulate pharmacokinetic and pharmacodynamic properties, leading to improved drug performance.
Used in Drug Discovery:
Pyrimidine, 5-fluoro-2-methoxy(8CI,9CI) is utilized in drug discovery processes to identify potential lead compounds with therapeutic potential. Its incorporation into diverse chemical libraries allows for the screening of a wide range of biological targets, facilitating the discovery of new treatments for various diseases.
Used in Chemical Synthesis:
Beyond its applications in the pharmaceutical industry, Pyrimidine, 5-fluoro-2-methoxy(8CI,9CI) also finds use in various chemical synthesis processes. Its unique reactivity and functional groups enable the production of a range of chemical products with diverse applications in research and industry.
Check Digit Verification of cas no
The CAS Registry Mumber 17148-49-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,7,1,4 and 8 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 17148-49:
(7*1)+(6*7)+(5*1)+(4*4)+(3*8)+(2*4)+(1*9)=111
111 % 10 = 1
So 17148-49-1 is a valid CAS Registry Number.
InChI:InChI=1/C5H5FN2O/c1-9-5-7-2-4(6)3-8-5/h2-3H,1H3
