171569-01-0 Usage
Uses
Used in Chemical Synthesis:
1,4-Diiodo-2,5-dioctylbenzene is used as a reagent in the chemical synthesis of other organic compounds. Its unique structure allows it to participate in a variety of chemical reactions, contributing to the formation of new molecules with different properties and applications.
Used in Laboratory Research:
1 4-DIIODO-2 5-DIOCTYLBENZENE is also utilized in laboratory research, where it can be employed to study various chemical reactions and processes. Its stability and non-reactivity make it an ideal candidate for controlled experiments and the investigation of reaction mechanisms.
Used in the Production of Specialty Chemicals:
1,4-Diiodo-2,5-dioctylbenzene finds application in the production of specialty chemicals, which are tailored for specific industries and applications. Its unique properties and reactivity can be harnessed to create chemicals with desired characteristics, such as improved performance or enhanced stability.
Check Digit Verification of cas no
The CAS Registry Mumber 171569-01-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,1,5,6 and 9 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 171569-01:
(8*1)+(7*7)+(6*1)+(5*5)+(4*6)+(3*9)+(2*0)+(1*1)=140
140 % 10 = 0
So 171569-01-0 is a valid CAS Registry Number.
InChI:InChI=1/C22H36I2/c1-3-5-7-9-11-13-15-19-17-22(24)20(18-21(19)23)16-14-12-10-8-6-4-2/h17-18H,3-16H2,1-2H3