171668-01-2 Usage
General Description
1-(2,4-diphenyl-1,5,7,9-tetrazabicyclo[4.3.0]nona-3,5,7-trien-8-yl)pyrrolidine-2,5-dione is a complex organic compound with a unique molecular structure. It contains a pyrrolidine-2,5-dione core with a 2,4-diphenyl-1,5,7,9-tetrazabicyclo[4.3.0]nona-3,5,7-trien-8-yl group attached. 1-(2,4-diphenyl-1,5,7,9-tetrazabicyclo[4.3.0]nona-3,5,7-trien-8-yl)pyr rolidine-2,5-dione has potential pharmaceutical applications due to its diverse chemical properties such as its ability to act as a ligand for metal complexation or ion recognition, as well as its potential for use in organic synthesis or medicinal chemistry. The compound's structural complexity and potential reactivity make it an interesting target for further study and potential applications in various fields of chemistry and biochemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 171668-01-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,1,6,6 and 8 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 171668-01:
(8*1)+(7*7)+(6*1)+(5*6)+(4*6)+(3*8)+(2*0)+(1*1)=142
142 % 10 = 2
So 171668-01-2 is a valid CAS Registry Number.
InChI:InChI=1/C21H17N5O2/c27-18-11-12-19(28)25(18)21-23-20-22-16(14-7-3-1-4-8-14)13-17(26(20)24-21)15-9-5-2-6-10-15/h1-10,13,17H,11-12H2,(H,22,23,24)