17172-76-8 Usage
Derivative of acetanilide
2-(4-acetylphenoxy)-n-phenyl-acetamid is derived from acetanilide, which is an organic compound used in the synthesis of various pharmaceuticals.
Contains a phenyl group
The compound has a phenyl group (a six-membered benzene ring with a hydrogen atom attached to each carbon atom) in its structure, which is a common structural unit in many organic compounds.
Contains an acetyl group
The molecule also includes an acetyl group (a two-carbon group with the structure -COCH3), which is a common functional group in many organic compounds and is known for its role in acetylation reactions.
Used in pharmaceutical research and drug development
2-(4-acetylphenoxy)-n-phenyl-acetamid is often utilized in the field of pharmaceutical research and drug development due to its potential therapeutic properties.
Potential as an analgesic
The compound may have analgesic (pain-relieving) properties, making it a promising candidate for the development of new pain management medications.
Potential as an anti-inflammatory agent
2-(4-acetylphenoxy)-n-phenyl-acetamid may also exhibit anti-inflammatory properties, which could be useful in the treatment of various inflammatory conditions.
Promising candidate for medicinal chemistry studies
The chemical structure and properties of 2-(4-acetylphenoxy)-n-phenyl-acetamid make it a valuable subject for further research in the field of medicinal chemistry.
Potential applications in organic synthesis
The presence of an acetyl group in the molecule suggests that 2-(4-acetylphenoxy)-n-phenyl-acetamid may have potential applications in organic synthesis and chemical reactions, such as acetylation reactions.
Check Digit Verification of cas no
The CAS Registry Mumber 17172-76-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,7,1,7 and 2 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 17172-76:
(7*1)+(6*7)+(5*1)+(4*7)+(3*2)+(2*7)+(1*6)=108
108 % 10 = 8
So 17172-76-8 is a valid CAS Registry Number.
InChI:InChI=1/C16H15NO3/c1-12(18)13-7-9-15(10-8-13)20-11-16(19)17-14-5-3-2-4-6-14/h2-10H,11H2,1H3,(H,17,19)
