17172-81-5 Usage
General Description
2-(4-ACETYL-PHENOXY)-N-O-TOLYL-ACETAMIDE is a chemical compound with the molecular formula C20H19NO3. It is a derivative of acetamide, containing an acetyl group, a phenoxy group, and a tolyl group attached to the amide nitrogen. 2-(4-ACETYL-PHENOXY)-N-O-TOLYL-ACETAMIDE is commonly used in pharmaceutical research as a potential drug candidate due to its anti-inflammatory and analgesic properties. It is also being investigated for its potential as a topically applied treatment for skin conditions. Additionally, it has been found to have potential insecticidal properties, making it a candidate for agricultural applications.
Check Digit Verification of cas no
The CAS Registry Mumber 17172-81-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,7,1,7 and 2 respectively; the second part has 2 digits, 8 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 17172-81:
(7*1)+(6*7)+(5*1)+(4*7)+(3*2)+(2*8)+(1*1)=105
105 % 10 = 5
So 17172-81-5 is a valid CAS Registry Number.
InChI:InChI=1/C17H17NO3/c1-12-5-3-4-6-16(12)18-17(20)11-21-15-9-7-14(8-10-15)13(2)19/h3-10H,11H2,1-2H3,(H,18,20)
