171809-13-5 Usage
Uses
Used in Pharmaceutical Industry:
3-Amino-6-fluoro-1-methylindazole is used as a key intermediate in the synthesis of various pharmaceuticals for its ability to contribute to the development of new drugs. Its presence in the molecular structure can influence the pharmacokinetics and pharmacodynamics of the resulting compounds, enhancing their therapeutic potential.
Used in Agrochemical Industry:
In the agrochemical sector, 3-Amino-6-fluoro-1-methylindazole is employed as a building block in the creation of agrochemicals, potentially leading to the development of novel pesticides or herbicides. Its incorporation can improve the effectiveness of these products and contribute to more sustainable agricultural practices.
Used in Medicinal Chemistry Research:
3-Amino-6-fluoro-1-methylindazole is utilized as a ligand in medicinal chemistry for its potential to interact with various biological targets. This makes it a valuable tool for understanding and modulating biological pathways, which is crucial for the advancement of drug discovery.
Used in Drug Discovery and Development:
As a compound with demonstrated biological activity, 3-Amino-6-fluoro-1-methylindazole is used in drug discovery and development processes. Its unique structural features allow it to be a versatile component in the design of new therapeutic agents, potentially leading to the creation of innovative treatments for a variety of diseases and conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 171809-13-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,1,8,0 and 9 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 171809-13:
(8*1)+(7*7)+(6*1)+(5*8)+(4*0)+(3*9)+(2*1)+(1*3)=135
135 % 10 = 5
So 171809-13-5 is a valid CAS Registry Number.
InChI:InChI=1/C8H8FN3/c1-12-7-4-5(9)2-3-6(7)8(10)11-12/h2-4H,1H3,(H2,10,11)
