171809-20-4 Usage
Uses
Used in Pharmaceutical Industry:
4-METHYL-3 5-DINITROBENZYL ALCOHOL 96 is used as an intermediate compound for the synthesis of various pharmaceuticals. Its unique structure allows it to be a key component in the development of new drugs with potential therapeutic applications.
Used in Chemical Synthesis:
In the chemical industry, 4-METHYL-3 5-DINITROBENZYL ALCOHOL 96 is used as a building block for the synthesis of other complex organic molecules. Its reactive functional groups make it a versatile starting material for the creation of a wide range of compounds with diverse applications.
Used in Research and Development:
4-METHYL-3 5-DINITROBENZYL ALCOHOL 96 is utilized as a research compound in academic and industrial laboratories. Its unique properties make it an interesting subject for studying various chemical reactions and exploring its potential applications in different fields.
Used in Dye and Pigment Industry:
Due to its characteristic color, 4-METHYL-3 5-DINITROBENZYL ALCOHOL 96 can be used as a starting material for the synthesis of dyes and pigments. Its chemical structure can be modified to produce a range of colors, making it a valuable asset in the dye and pigment industry.
Used in Explosives Industry:
The presence of nitro groups in the molecule makes 4-METHYL-3 5-DINITROBENZYL ALCOHOL 96 a potential candidate for use in the explosives industry. Its high energy content and reactivity can be harnessed to develop new explosive materials with specific properties and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 171809-20-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,1,8,0 and 9 respectively; the second part has 2 digits, 2 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 171809-20:
(8*1)+(7*7)+(6*1)+(5*8)+(4*0)+(3*9)+(2*2)+(1*0)=134
134 % 10 = 4
So 171809-20-4 is a valid CAS Registry Number.
InChI:InChI=1/C8H8N2O5/c1-5-7(9(12)13)2-6(4-11)3-8(5)10(14)15/h2-3,11H,4H2,1H3
