171853-10-4 Usage
Description
(Z)-3-amino-3-[(4-methoxyphenyl)methylamino]-2-[(Z)-(3-oxo-1H-indol-2ylidene)methyl]prop-2-enenitrile is a complex organic compound characterized by the presence of multiple functional groups, including an amino group, a methoxyphenyl group, an indole ring, a propenenitrile chain with a ketone, and an imine group. These structural features suggest potential biological activities, such as antimicrobial, antifungal, or anticancer properties, although further research is required to confirm these possibilities.
Uses
Used in Pharmaceutical Industry:
(Z)-3-amino-3-[(4-methoxyphenyl)methylamino]-2-[(Z)-(3-oxo-1H-indol-2ylidene)methyl]prop-2-enenitrile is used as a potential therapeutic agent for various applications due to its complex structure and the presence of multiple functional groups that may exhibit biological activities.
Used in Antimicrobial Applications:
In the field of antimicrobial research, (Z)-3-amino-3-[(4-methoxyphenyl)methylamino]-2-[(Z)-(3-oxo-1H-indol-2ylidene)methyl]prop-2-enenitrile may be utilized as a compound with potential antimicrobial properties, given its structural composition and the presence of functional groups that could interact with microbial cells.
Used in Antifungal Applications:
Similarly, in antifungal research, (Z)-3-amino-3-[(4-methoxyphenyl)methylamino]-2-[(Z)-(3-oxo-1H-indol-2ylidene)methyl]prop-2-enenitrile could be explored for its potential to combat fungal infections, leveraging its complex molecular structure and functional groups.
Used in Anticancer Applications:
(Z)-3-amino-3-[(4-methoxyphenyl)methylamino]-2-[(Z)-(3-oxo-1H-indol-2ylidene)methyl]prop-2-enenitrile may also be investigated for its potential as an anticancer agent, considering the presence of functional groups that could target cancer cells and modulate relevant signaling pathways.
Used in Chemical Research:
In the field of chemical research, (Z)-3-amino-3-[(4-methoxyphenyl)methylamino]-2-[(Z)-(3-oxo-1H-indol-2ylidene)methyl]prop-2-enenitrile serves as a subject of study for understanding its synthesis, reactivity, and potential applications in various chemical processes and reactions.
Check Digit Verification of cas no
The CAS Registry Mumber 171853-10-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,1,8,5 and 3 respectively; the second part has 2 digits, 1 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 171853-10:
(8*1)+(7*7)+(6*1)+(5*8)+(4*5)+(3*3)+(2*1)+(1*0)=134
134 % 10 = 4
So 171853-10-4 is a valid CAS Registry Number.
InChI:InChI=1/C20H18N4O2/c1-26-15-8-6-13(7-9-15)12-23-20(22)14(11-21)10-18-19(25)16-4-2-3-5-17(16)24-18/h2-10,23-24H,12,22H2,1H3/b18-10-,20-14-