171853-12-6 Usage
General Description
(Z)-3-amino-2-[(Z)-(3-oxo-1H-indol-2-ylidene)methyl]-3-(1-phenylethylamino)prop-2-enenitrile is a chemical compound with a complex structure. It contains an amino group, an indole ring, and a nitrile group, among other functional groups. The compound also has a (Z)-configuration and is a derivative of phenylethylamine. Its precise chemical structure suggests that it may have potential biological or pharmaceutical activities, but further research would be needed to fully understand its properties and potential applications.
Check Digit Verification of cas no
The CAS Registry Mumber 171853-12-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,1,8,5 and 3 respectively; the second part has 2 digits, 1 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 171853-12:
(8*1)+(7*7)+(6*1)+(5*8)+(4*5)+(3*3)+(2*1)+(1*2)=136
136 % 10 = 6
So 171853-12-6 is a valid CAS Registry Number.
InChI:InChI=1/C20H18N4O/c1-13(14-7-3-2-4-8-14)23-20(22)15(12-21)11-18-19(25)16-9-5-6-10-17(16)24-18/h2-11,13,23-24H,22H2,1H3/b18-11-,20-15-