171853-15-9 Usage
General Description
The chemical compound "(Z)-3-amino-2-[(Z)-(3-oxo-1H-indol-2-ylidene)methyl]-3-(1-phenylpropan-2-ylamino)prop-2-enenitrile" is a complex organic molecule with a long and specific structure. It contains an amino group, a nitrile group, and an indole ring. The compound also has a phenyl group attached to a propyl group. The presence of the indole ring suggests potential biological activity, as many naturally occurring alkaloids and pharmaceuticals contain this structural motif. The compound's unique structure and combination of functional groups may make it of interest for medicinal chemistry research, potentially as a starting point for the development of new drugs with therapeutic applications. However, further studies and evaluations would be needed to determine its specific properties and potential uses.
Check Digit Verification of cas no
The CAS Registry Mumber 171853-15-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,1,8,5 and 3 respectively; the second part has 2 digits, 1 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 171853-15:
(8*1)+(7*7)+(6*1)+(5*8)+(4*5)+(3*3)+(2*1)+(1*5)=139
139 % 10 = 9
So 171853-15-9 is a valid CAS Registry Number.
InChI:InChI=1/C21H20N4O/c1-14(11-15-7-3-2-4-8-15)24-21(23)16(13-22)12-19-20(26)17-9-5-6-10-18(17)25-19/h2-10,12,14,24-25H,11,23H2,1H3/b19-12-,21-16-