17205-02-6 Usage
Uses
Used in Chemical Research:
3-Hydroxy-cyclobutanecarboxylic acid ethyl ester is used as a research compound for its stable chemical properties and unique cyclobutane structure. It aids in the study of chemical reactions and the development of new synthetic pathways.
Used in Pharmaceutical Development:
3-Hydroxy-cyclobutanecarboxylic acid ethyl ester is used as a potential pharmaceutical intermediate due to its cyclobutane moiety, which may contribute to the development of new drug molecules with novel therapeutic properties.
Used in Material Science:
3-Hydroxy-cyclobutanecarboxylic acid ethyl ester is used as a component in the synthesis of advanced materials, such as polymers and composites, where its cyclobutane structure can impart unique mechanical or chemical properties.
Used in Industrial Applications:
3-Hydroxy-cyclobutanecarboxylic acid ethyl ester is used as a chemical intermediate in the production of various industrial chemicals, taking advantage of its reactivity and cyclobutane structure to create new compounds with specific applications.
Check Digit Verification of cas no
The CAS Registry Mumber 17205-02-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,7,2,0 and 5 respectively; the second part has 2 digits, 0 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 17205-02:
(7*1)+(6*7)+(5*2)+(4*0)+(3*5)+(2*0)+(1*2)=76
76 % 10 = 6
So 17205-02-6 is a valid CAS Registry Number.
InChI:InChI=1/C7H12O3/c1-2-10-7(9)5-3-6(8)4-5/h5-6,8H,2-4H2,1H3
