172800-03-2 Usage
General Description
The chemical [(1R,2R)-2-(1-piperidylmethyl)cycloheptyl] N-(2-butoxyphenyl)carbamate hydrochloride is a compound with a complex molecular structure. It is a salt form of a carbamate compound, with a piperidylmethyl and butoxyphenyl group attached to the carbon atom. This chemical is likely to have pharmaceutical applications, possibly as a potential therapeutic agent due to the presence of a carbamate moiety, which is often found in drugs such as muscle relaxants and insecticides. The hydrochloride salt form of this compound suggests that it may have improved solubility and stability in aqueous solutions, making it potentially suitable for use in medical or pharmaceutical applications. However, further studies and research are required to fully understand its properties and potential uses.
Check Digit Verification of cas no
The CAS Registry Mumber 172800-03-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,2,8,0 and 0 respectively; the second part has 2 digits, 0 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 172800-03:
(8*1)+(7*7)+(6*2)+(5*8)+(4*0)+(3*0)+(2*0)+(1*3)=112
112 % 10 = 2
So 172800-03-2 is a valid CAS Registry Number.
InChI:InChI=1/C24H38N2O3.ClH/c1-2-3-18-28-23-15-9-8-13-21(23)25-24(27)29-22-14-7-4-6-12-20(22)19-26-16-10-5-11-17-26;/h8-9,13,15,20,22H,2-7,10-12,14,16-19H2,1H3,(H,25,27);1H/t20-,22-;/m1./s1