172932-10-4 Usage
Uses
Used in Pharmaceutical Industry:
4-(2-CHLORO-6-FLUOROBENZYLOXY)BENZALDEHYDE is used as a building block for the synthesis of various pharmaceuticals, contributing to the development of new drugs and therapeutic agents. Its unique chemical structure allows for the creation of molecules with specific biological activities, making it a valuable component in medicinal chemistry.
Used in Agrochemical Industry:
In the agrochemical sector, 4-(2-CHLORO-6-FLUOROBENZYLOXY)BENZALDEHYDE is utilized as a precursor in the production of agrochemicals, such as pesticides and herbicides. Its chemical properties enable the design of compounds that can effectively control, manage, and protect crops from pests and diseases.
Used as an Intermediate in Organic Synthesis:
4-(2-CHLORO-6-FLUOROBENZYLOXY)BENZALDEHYDE is employed as an intermediate in the synthesis of other organic compounds, facilitating the creation of a wide range of chemical products. Its versatility in organic reactions makes it a useful component in various chemical processes, contributing to the synthesis of diverse molecules with different applications.
Check Digit Verification of cas no
The CAS Registry Mumber 172932-10-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,2,9,3 and 2 respectively; the second part has 2 digits, 1 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 172932-10:
(8*1)+(7*7)+(6*2)+(5*9)+(4*3)+(3*2)+(2*1)+(1*0)=134
134 % 10 = 4
So 172932-10-4 is a valid CAS Registry Number.
InChI:InChI=1/C14H10ClFO2/c15-13-2-1-3-14(16)12(13)9-18-11-6-4-10(8-17)5-7-11/h1-8H,9H2
