17315-76-3 Usage
General Description
2-Hydroxyglutaconianil hydrochloride is a chemical compound that is a derivative of glutaric acid. It is used in laboratory research as a reagent for the detection and quantification of amino acids. It is also utilized in the synthesis of pharmaceutical compounds, particularly those with anti-inflammatory and analgesic properties. 2-HYDROXYGLUTACONDIANIL HYDROCHLORIDE is known for its ability to form complexes with metal ions, making it useful in certain analytical techniques. Additionally, 2-Hydroxyglutaconianil hydrochloride has potential applications in the development of new materials and polymers due to its unique chemical structure and properties.
Check Digit Verification of cas no
The CAS Registry Mumber 17315-76-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,7,3,1 and 5 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 17315-76:
(7*1)+(6*7)+(5*3)+(4*1)+(3*5)+(2*7)+(1*6)=103
103 % 10 = 3
So 17315-76-3 is a valid CAS Registry Number.
InChI:InChI=1/C17H16N2O/c20-17(14-19-16-10-5-2-6-11-16)12-7-13-18-15-8-3-1-4-9-15/h1-14,18,20H/b13-7+,17-12-,19-14+
