173159-45-0 Usage
General Description
2-Methyl-imidazo[1,2-a]pyridin-8-ylamine, hydrochloride is a chemical compound with potential biological and pharmacological properties. It is a derivative of imidazo[1,2-a]pyridine, which has been found to exhibit antitumor and antimicrobial activities. The hydrochloride salt form of this compound is often used in the pharmaceutical industry for the development of novel drugs targeting various diseases, including cancer and infectious diseases. Its precise mechanism of action and specific uses may vary, but its unique structure and potential therapeutic effects make it a promising candidate for further research and drug development.
Check Digit Verification of cas no
The CAS Registry Mumber 173159-45-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,3,1,5 and 9 respectively; the second part has 2 digits, 4 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 173159-45:
(8*1)+(7*7)+(6*3)+(5*1)+(4*5)+(3*9)+(2*4)+(1*5)=140
140 % 10 = 0
So 173159-45-0 is a valid CAS Registry Number.
InChI:InChI=1/C8H9N3.ClH/c1-6-5-11-4-2-3-7(9)8(11)10-6;/h2-5H,9H2,1H3;1H
