17329-32-7 Usage
Uses
Used in Pharmaceutical Industry:
2-(2-HYDROXY-ETHYL)-1,3-DIOXO-2,3-DIHYDRO-1H-ISOINDOLE-5-CARBOXYLIC ACID is used as a potential drug candidate for its structural similarity to compounds that target isoindole receptors. Its unique chemical properties and potential interactions with biological systems make it a valuable compound for further research and development in the pharmaceutical industry.
Used in Medicinal Chemistry:
2-(2-HYDROXY-ETHYL)-1,3-DIOXO-2,3-DIHYDRO-1H-ISOINDOLE-5-CARBOXYLIC ACID is used as a compound of interest in medicinal chemistry for its potential to interact with biological systems and exhibit biological activity. Its carboxylic acid, hydroxyl, and dioxo functional groups provide opportunities for further modification and optimization to enhance its therapeutic potential.
Used in Drug Development:
2-(2-HYDROXY-ETHYL)-1,3-DIOXO-2,3-DIHYDRO-1H-ISOINDOLE-5-CARBOXYLIC ACID is used as a starting point for drug development due to its potential pharmaceutical applications. Its unique structure and functional groups offer opportunities for the design and synthesis of new drugs targeting isoindole receptors, with the aim of developing novel therapeutic agents for various diseases and conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 17329-32-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,7,3,2 and 9 respectively; the second part has 2 digits, 3 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 17329-32:
(7*1)+(6*7)+(5*3)+(4*2)+(3*9)+(2*3)+(1*2)=107
107 % 10 = 7
So 17329-32-7 is a valid CAS Registry Number.
InChI:InChI=1/C11H9NO5/c13-4-3-12-9(14)7-2-1-6(11(16)17)5-8(7)10(12)15/h1-2,5,13H,3-4H2,(H,16,17)/p-1
