1733-97-7 Usage
Chemical group
Pyridinium group A positively charged aromatic ring derived from pyridine.
Applications
Organic synthesis and disinfectant Used in various applications, including the synthesis of organic compounds and as a disinfectant.
Type of compound
Quaternary ammonium salt Contains a positively charged nitrogen atom bonded to four organic groups.
Structural components
Pyridine ring and naphthylmethyl group The compound consists of a pyridine ring with a naphthylmethyl group attached to it.
Counterion
Chloride As a chloride salt, it is often used as a source of the 1-(naphthylmethyl)pyridinium cation in various chemical reactions.
Reactivity
Valuable in organic chemistry and chemical research Its properties and reactivity make it a valuable compound in the field of organic chemistry and chemical research.
Check Digit Verification of cas no
The CAS Registry Mumber 1733-97-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,7,3 and 3 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 1733-97:
(6*1)+(5*7)+(4*3)+(3*3)+(2*9)+(1*7)=87
87 % 10 = 7
So 1733-97-7 is a valid CAS Registry Number.
InChI:InChI=1/C16H14N.ClH/c1-4-11-17(12-5-1)13-15-9-6-8-14-7-2-3-10-16(14)15;/h1-12H,13H2;1H/q+1;/p-1
