173689-78-6 Usage
Chemical Classification
It is a derivative of quinolone.
Explanation
Different sources of media describe the Explanation of 173689-78-6 differently. You can refer to the following data:
1. Quinolone is a class of synthetic antibacterial agents, and this compound belongs to that category.
2. Fluoroquinolones are a subgroup of quinolone antibiotics that contain a fluorine atom and are known for their broad-spectrum activity against various bacteria.
3. As a hydrochloride salt, the compound is water-soluble, which allows for easier administration through oral or intravenous routes.
4. By inhibiting DNA gyrase, the compound prevents the replication and repair of bacterial DNA, ultimately leading to bacterial death.
5. Due to its ability to inhibit DNA gyrase, the compound is effective against various types of bacterial infections.
6. The specific chemical structure of the compound contributes to its properties and effectiveness as an antibiotic.
Type of Antibiotic
It is a member of the fluoroquinolone class.
Form
It is a hydrochloride salt.
Mechanism of Action
Inhibits bacterial enzyme DNA gyrase.
Effectiveness
Treats a wide range of bacterial infections.
Chemical Structure
1-cyclopropyl-6-fluoro-5-methyl-7-(3-methylpiperazin-1-yl)-4-oxo-2,3-dihydroquinoline-3-carboxylic acid.
Check Digit Verification of cas no
The CAS Registry Mumber 173689-78-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,3,6,8 and 9 respectively; the second part has 2 digits, 7 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 173689-78:
(8*1)+(7*7)+(6*3)+(5*6)+(4*8)+(3*9)+(2*7)+(1*8)=186
186 % 10 = 6
So 173689-78-6 is a valid CAS Registry Number.
InChI:InChI=1/C19H24FN3O3.ClH/c1-10-8-22(6-5-21-10)15-7-14-16(11(2)17(15)20)18(24)13(19(25)26)9-23(14)12-3-4-12;/h7,10,12-13,21H,3-6,8-9H2,1-2H3,(H,25,26);1H