173731-96-9 Usage
Uses
Used in Pharmaceutical Industry:
Benzoic acid, 4-[(aminoiminomethyl)amino]-2-methoxy(9CI) is used as an intermediate in the synthesis of various drugs. Its unique chemical structure allows it to be a key component in the development of new pharmaceuticals.
Used in Chemical Synthesis:
As a chemical reagent, Benzoic acid, 4-[(aminoiminomethyl)amino]-2-methoxy(9CI) is employed in organic synthesis processes, contributing to the creation of a wide range of chemical products.
Used in Dye and Pigment Production:
Benzoic acid, 4-[(aminoiminomethyl)amino]-2-methoxy(9CI) is also utilized in the production of dyes and pigments, where its chemical properties contribute to the color and stability of these products.
Used in Medicine:
Due to its antimicrobial properties, Benzoic acid, 4-[(aminoiminomethyl)amino]-2-methoxy(9CI) has potential applications in medicine, where it could be used to combat various microbial infections.
Used in Biotechnology:
In the field of biotechnology, Benzoic acid, 4-[(aminoiminomethyl)amino]-2-methoxy(9CI) is being explored for its potential as an anti-cancer agent, indicating its possible role in the development of novel therapeutic approaches to cancer treatment.
Check Digit Verification of cas no
The CAS Registry Mumber 173731-96-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,3,7,3 and 1 respectively; the second part has 2 digits, 9 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 173731-96:
(8*1)+(7*7)+(6*3)+(5*7)+(4*3)+(3*1)+(2*9)+(1*6)=149
149 % 10 = 9
So 173731-96-9 is a valid CAS Registry Number.
InChI:InChI=1/C9H11N3O3/c1-15-7-4-5(12-9(10)11)2-3-6(7)8(13)14/h2-4H,1H3,(H,13,14)(H4,10,11,12)
