17380-07-3 Usage
Description
2-CHLORO-1-(1H-INDOL-3-YL)PROPAN-1-ONE is a chemical compound characterized by the molecular formula C11H10ClNO. It is an indole derivative featuring a chlorine atom and a propionone group, which contributes to its unique chemical properties and potential applications in various fields.
Uses
Used in Organic Synthesis:
2-CHLORO-1-(1H-INDOL-3-YL)PROPAN-1-ONE is used as a key intermediate in organic synthesis for the production of various chemical compounds. Its versatile structure allows for further functionalization and modification, making it a valuable building block in the synthesis of complex organic molecules.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 2-CHLORO-1-(1H-INDOL-3-YL)PROPAN-1-ONE serves as a crucial component in drug discovery and development. Its indole-based structure provides a foundation for the design of new pharmaceutical agents with potential therapeutic benefits.
Used in Drug Production:
2-CHLORO-1-(1H-INDOL-3-YL)PROPAN-1-ONE is utilized in the manufacturing process of various drugs and pharmaceutical intermediates. Its presence in the molecular structure of these compounds contributes to their pharmacological properties and therapeutic effects.
Used in the Synthesis of Natural Products:
2-CHLORO-1-(1H-INDOL-3-YL)PROPAN-1-ONE is employed as a synthetic precursor in the preparation of natural products. Its structural features enable the replication of complex natural molecules, facilitating the development of novel bioactive compounds with potential applications in medicine and healthcare.
Used in the Synthesis of Heterocyclic Compounds:
2-CHLORO-1-(1H-INDOL-3-YL)PROPAN-1-ONE is used as a starting material in the synthesis of heterocyclic compounds, which are known for their diverse range of biological activities. Its indole-based structure allows for the formation of various heterocyclic systems with potential applications in pharmaceuticals and materials science.
Used in the Development of New Drugs with Biological Activities:
The presence of the indole group in 2-CHLORO-1-(1H-INDOL-3-YL)PROPAN-1-ONE makes it a promising candidate for the development of new drugs with biological activities. Its unique chemical properties and structural features can be exploited to design and synthesize novel pharmaceutical agents with potential therapeutic benefits in various medical conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 17380-07-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,7,3,8 and 0 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 17380-07:
(7*1)+(6*7)+(5*3)+(4*8)+(3*0)+(2*0)+(1*7)=103
103 % 10 = 3
So 17380-07-3 is a valid CAS Registry Number.
InChI:InChI=1/C11H10ClNO/c1-7(12)11(14)9-6-13-10-5-3-2-4-8(9)10/h2-7,13H,1H3