17386-15-1 Usage
General Description
1-[(2-Methyl-1,3-thiazol-4-yl)methyl]piperidine is a chemical compound with the molecular formula C11H18N2S. It is a piperidine derivative with a thiazole ring attached to the methyl group. 1-[(2-METHYL-1,3-THIAZOL-4-YL)METHYL]PIPERIDINE is commonly used in pharmaceutical research and drug development as a building block for the synthesis of various bioactive compounds. It is also being studied for its potential pharmacological properties, including its ability to interact with certain receptors in the central nervous system. Additionally, 1-[(2-methyl-1,3-thiazol-4-yl)methyl]piperidine has been investigated for its potential anti-inflammatory and analgesic effects, making it a promising candidate for the development of new therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 17386-15-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,7,3,8 and 6 respectively; the second part has 2 digits, 1 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 17386-15:
(7*1)+(6*7)+(5*3)+(4*8)+(3*6)+(2*1)+(1*5)=121
121 % 10 = 1
So 17386-15-1 is a valid CAS Registry Number.
InChI:InChI=1/C10H16N2S/c1-9-11-10(8-13-9)7-12-5-3-2-4-6-12/h8H,2-7H2,1H3/p+1