17399-24-5 Usage
General Description
3-(Phenethyloxy)aniline hydrochloride is a chemical compound that consists of a phenyl ring with an attached ethoxy group and an amino group. The hydrochloride salt form of this compound is used in various research and industrial applications. It can be used as a building block in the synthesis of pharmaceuticals, agrochemicals, and other organic compounds. Its properties and structure make it suitable for use in organic reactions and as a precursor in the production of other compounds. Additionally, it may have potential applications in the development of new materials and technologies, making it a valuable chemical in the field of organic chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 17399-24-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,7,3,9 and 9 respectively; the second part has 2 digits, 2 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 17399-24:
(7*1)+(6*7)+(5*3)+(4*9)+(3*9)+(2*2)+(1*4)=135
135 % 10 = 5
So 17399-24-5 is a valid CAS Registry Number.
InChI:InChI=1/C14H15NO/c15-13-7-4-8-14(11-13)16-10-9-12-5-2-1-3-6-12/h1-8,11H,9-10,15H2