17399-25-6 Usage
General Description
[3-(3-Phenylpropoxy)phenyl]amine hydrochloride is a chemical compound with the molecular formula C15H18ClNO. It is an amine hydrochloride derivative with a molecular weight of 269.76 g/mol and a melting point of 256-258°C. [3-(3-Phenylpropoxy)phenyl]amine hydrochloride is commonly used in organic synthesis and pharmaceutical research as a building block for the synthesis of new compounds and drugs. It may also have potential applications in the field of medicinal chemistry and drug discovery due to its structural features and biological activities. As a hydrochloride salt, it is a stable and water-soluble compound that can be easily handled and stored for various laboratory and industrial purposes.
Check Digit Verification of cas no
The CAS Registry Mumber 17399-25-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,7,3,9 and 9 respectively; the second part has 2 digits, 2 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 17399-25:
(7*1)+(6*7)+(5*3)+(4*9)+(3*9)+(2*2)+(1*5)=136
136 % 10 = 6
So 17399-25-6 is a valid CAS Registry Number.
InChI:InChI=1/C15H17NO/c16-14-9-4-10-15(12-14)17-11-5-8-13-6-2-1-3-7-13/h1-4,6-7,9-10,12H,5,8,11,16H2
