174097-31-5 Usage
Description
[4-(2-AMINO-2-CARBOXYETHYL)PHENOXY]-PROPANEDIOIC ACID, with the molecular formula C13H17NO7, is a chemical compound derived from phenoxyacetic acid and propanedioic acid. It features an amino group and a carboxylic acid group, which may contribute to its potential pharmaceutical applications and various biological activities. Further research is necessary to fully comprehend its properties and possible uses.
Uses
Used in Pharmaceutical Applications:
[4-(2-AMINO-2-CARBOXYETHYL)PHENOXY]-PROPANEDIOIC ACID is used as a potential pharmaceutical compound for its possible biological activities and therapeutic effects. The presence of an amino group and a carboxylic acid group in its structure suggests that it may interact with biological systems in various ways, making it a candidate for further investigation in the development of new drugs.
Used in Research and Development:
In the field of scientific research, [4-(2-AMINO-2-CARBOXYETHYL)PHENOXY]-PROPANEDIOIC ACID serves as a valuable compound for studying its chemical properties, reactivity, and potential interactions with biological molecules. This research could lead to a better understanding of its applications in drug design and development, as well as other areas of chemistry and biology.
Check Digit Verification of cas no
The CAS Registry Mumber 174097-31-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,4,0,9 and 7 respectively; the second part has 2 digits, 3 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 174097-31:
(8*1)+(7*7)+(6*4)+(5*0)+(4*9)+(3*7)+(2*3)+(1*1)=145
145 % 10 = 5
So 174097-31-5 is a valid CAS Registry Number.
InChI:InChI=1/C12H13NO7/c13-8(10(14)15)5-6-1-3-7(4-2-6)20-9(11(16)17)12(18)19/h1-4,8-9H,5,13H2,(H,14,15)(H,16,17)(H,18,19)