174097-31-5 Usage
Uses
Used in Pharmaceutical Applications:
[4-(2-AMINO-2-CARBOXYETHYL)PHENOXY]-PROPANEDIOIC ACID is used as a potential pharmaceutical compound for its possible biological activities and therapeutic effects. The presence of an amino group and a carboxylic acid group in its structure suggests that it may interact with biological systems in various ways, making it a candidate for further investigation in the development of new drugs.
Used in Research and Development:
In the field of scientific research, [4-(2-AMINO-2-CARBOXYETHYL)PHENOXY]-PROPANEDIOIC ACID serves as a valuable compound for studying its chemical properties, reactivity, and potential interactions with biological molecules. This research could lead to a better understanding of its applications in drug design and development, as well as other areas of chemistry and biology.
Check Digit Verification of cas no
The CAS Registry Mumber 174097-31-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,4,0,9 and 7 respectively; the second part has 2 digits, 3 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 174097-31:
(8*1)+(7*7)+(6*4)+(5*0)+(4*9)+(3*7)+(2*3)+(1*1)=145
145 % 10 = 5
So 174097-31-5 is a valid CAS Registry Number.
InChI:InChI=1/C12H13NO7/c13-8(10(14)15)5-6-1-3-7(4-2-6)20-9(11(16)17)12(18)19/h1-4,8-9H,5,13H2,(H,14,15)(H,16,17)(H,18,19)
