174198-16-4 Usage
Class
Morpholines
2,9-Dimorpholino-13-thiabicyclo(8.2.1)tridec-5-ene 13-oxide belongs to the class of organic compounds known as morpholines.
Reactivity
Highly reactive
The compound is known for its high reactivity, which makes it useful in various industrial processes but also requires careful handling.
Stability
Unstable
The compound is unstable, which contributes to its reactivity and the need for cautious handling.
Use as a crosslinking agent
Polymer and resin production
2,9-Dimorpholino-13-thiabicyclo(8.2.1)tridec-5-ene 13-oxide is commonly used to promote crosslinking in the production of polymers and resins.
Curing and hardening agent
Plastics and rubber manufacturing
The chemical is also used as a curing and hardening agent in the manufacturing of plastics and rubber products.
7. Applications in adhesives and coatings production
The compound has applications in the production of adhesives and coatings due to its unique molecular structure and properties.
Industrial value
Valuable ingredient
The unique molecular structure and properties of 2,9-Dimorpholino-13-thiabicyclo(8.2.1)tridec-5-ene 13-oxide make it a valuable ingredient in various industrial processes.
Handling precautions
Reactivity and potential risks
Due to its reactivity and potential risks, the compound requires careful handling to ensure safety during its use in industrial processes.
Check Digit Verification of cas no
The CAS Registry Mumber 174198-16-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,4,1,9 and 8 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 174198-16:
(8*1)+(7*7)+(6*4)+(5*1)+(4*9)+(3*8)+(2*1)+(1*6)=154
154 % 10 = 4
So 174198-16-4 is a valid CAS Registry Number.
InChI:InChI=1/C20H34N2O3S/c23-26-19-7-8-20(26)18(22-11-15-25-16-12-22)6-4-2-1-3-5-17(19)21-9-13-24-14-10-21/h1-2,17-20H,3-16H2/b2-1-