1742-14-9 Usage
Description
1,1-Bis(3,4-dimethylphenyl)ethane, also known as chiral ligand 3 or DIOP, is a chemical compound with the molecular formula C22H26. It is a colorless to pale yellow liquid at room temperature and is commonly used as a ligand in organometallic chemistry and asymmetric catalysis. It is a chiral compound with two optically active carbon atoms, making it an important building block for the synthesis of chiral drugs and molecules. 1,1-Bis(3,4-dimethylphenyl)ethane has been widely studied for its applications in the pharmaceutical and agrochemical industries, and its complex structure makes it a valuable tool in the development of new chemical processes and synthetic methodologies.
Uses
Used in Pharmaceutical Industry:
1,1-Bis(3,4-dimethylphenyl)ethane is used as a chiral ligand for the synthesis of chiral drugs and molecules, due to its ability to induce enantioselectivity in chemical reactions. This allows for the production of enantiomerically pure compounds, which are essential for the development of effective and safe pharmaceuticals.
Used in Agrochemical Industry:
1,1-Bis(3,4-dimethylphenyl)ethane is used as a chiral ligand in the synthesis of chiral agrochemicals, such as pesticides and herbicides. The enantioselective synthesis of these compounds can lead to more effective and environmentally friendly products, as only the desired enantiomer is active, reducing the impact of the undesired enantiomer on non-target organisms.
Used in Organometallic Chemistry:
1,1-Bis(3,4-dimethylphenyl)ethane is used as a ligand in organometallic chemistry, where it can influence the reactivity and selectivity of metal complexes. This allows for the development of new catalytic systems and synthetic methodologies, enabling the efficient synthesis of complex organic molecules.
Used in Asymmetric Catalysis:
1,1-Bis(3,4-dimethylphenyl)ethane is used as a chiral ligand in asymmetric catalysis, where it can induce enantioselectivity in catalytic reactions. This is crucial for the synthesis of enantiomerically pure compounds, which are often required in various applications, such as pharmaceuticals, agrochemicals, and fine chemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 1742-14-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,7,4 and 2 respectively; the second part has 2 digits, 1 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 1742-14:
(6*1)+(5*7)+(4*4)+(3*2)+(2*1)+(1*4)=69
69 % 10 = 9
So 1742-14-9 is a valid CAS Registry Number.
InChI:InChI=1/C18H22/c1-12-6-8-17(10-14(12)3)16(5)18-9-7-13(2)15(4)11-18/h6-11,16H,1-5H3
1742-14-9Relevant articles and documents
Structural requirements for decarbonylative α,α-diarylation reaction of 2-methoxyalkanoic acids in phosphorus pentoxide-methanesulfonic acid mixture yielding 1,1-diarylalkane homologs
Yonezawa, Noriyuki,Hino, Tetsuo,Tokita, Yoshimi,Matsuda, Kazuhisa,Ikeda, Tomiki
, p. 14287 - 14296 (2007/10/03)
2-Methoxyalkanoic acids were found to undergo consecutive decarbonylative α,α-diarylation in P2O5-MsOH instead of Friedel-Crafts type arylation on the carbonyl carbon. The influence of the substituents of the arenes and the carboxylic acids in this reaction was elucidated based on the reaction yields. The reaction behavior was found to be primarily governed by the electron-withdrawing/releasing property of the α-substituents on the carboxylic acids as well as the positive species-accepting ability of the arenes. The steric hindrance was shown to participate in determining the reaction feasibility as a secondary factor.