1742-90-1 Usage
Explanation
Different sources of media describe the Explanation of 1742-90-1 differently. You can refer to the following data:
1. This is the chemical name of the compound, which is a thiazole-based cationic dye.
2. The compound is classified as a dye based on thiazole, which is a heterocyclic organic compound.
3. The compound includes a chloride ion (Cl-) as a counterion, which balances the positive charge of the cationic dye.
4. It is commonly used in the textile industry as a dye for fabric and other materials.
5. The compound has a long and specific molecular structure, which includes numerous interconnected aromatic rings and functional groups.
6. Due to its complex structure, the compound is an effective and versatile dye for a variety of applications.
7. The unique molecular structure allows it to bind to various fabrics and materials, providing long-lasting and vibrant coloration.
8. The chemical compound is an important ingredient in the production of colored textiles and materials, contributing to their appearance and quality.
Type
Thiazole-based cationic dye
Contains
Chloride ion
Application
Textile industry
Structure
Long and complex
Effectiveness
Versatile dye
Binding capability
Different types of fabrics and materials
Importance
Production of colored textiles and materials
Check Digit Verification of cas no
The CAS Registry Mumber 1742-90-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,7,4 and 2 respectively; the second part has 2 digits, 9 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 1742-90:
(6*1)+(5*7)+(4*4)+(3*2)+(2*9)+(1*0)=81
81 % 10 = 1
So 1742-90-1 is a valid CAS Registry Number.
InChI:InChI=1/C29H25N2S2.ClH/c1-4-19(17-26-30(2)28-22-11-7-5-9-20(22)13-15-24(28)32-26)18-27-31(3)29-23-12-8-6-10-21(23)14-16-25(29)33-27;/h5-18H,4H2,1-3H3;1H/q+1;/p-1