174469-94-4 Usage
Chemical class
Amines
Molecular structure
Unique, composed of carbon, hydrogen, nitrogen, and oxygen atoms
Spirocyclic structure
Provides stability and unique reactivity properties
Research fields
Organic chemistry and pharmaceuticals
Ability
Forms complex molecular structures, potential biological activity
Potential applications
Synthesis of various drugs, building block for new chemical compounds
Check Digit Verification of cas no
The CAS Registry Mumber 174469-94-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,4,4,6 and 9 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 174469-94:
(8*1)+(7*7)+(6*4)+(5*4)+(4*6)+(3*9)+(2*9)+(1*4)=174
174 % 10 = 4
So 174469-94-4 is a valid CAS Registry Number.
InChI:InChI=1/C9H18N2O/c10-8-2-1-7-12-9(8)3-5-11-6-4-9/h8,11H,1-7,10H2