17452-16-3 Usage
General Description
1-(2,3-Dimethylphenyl)-1H-imidazole-2-thiol is a chemical compound with the molecular formula C10H11N3S. It is an imidazole derivative that contains a thiol group, which gives it unique chemical properties. 1-(2,3-DIMETHYLPHENYL)-1H-IMIDAZOLE-2-THIOL is commonly used in pharmaceutical research for its potential pharmacological activities, such as antimicrobial and antifungal properties. Its structure and reactivity make it a valuable tool in drug design and development, particularly for creating new therapeutics for infectious diseases and other medical conditions. Additionally, 1-(2,3-Dimethylphenyl)-1H-imidazole-2-thiol may also be used as a reagent in organic synthesis and chemical reactions due to its ability to undergo various transformations and form new chemical bonds.
Check Digit Verification of cas no
The CAS Registry Mumber 17452-16-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,7,4,5 and 2 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 17452-16:
(7*1)+(6*7)+(5*4)+(4*5)+(3*2)+(2*1)+(1*6)=103
103 % 10 = 3
So 17452-16-3 is a valid CAS Registry Number.
InChI:InChI=1/C11H12N2S/c1-8-4-3-5-10(9(8)2)13-7-6-12-11(13)14/h3-7H,1-2H3,(H,12,14)