17452-26-5 Usage
Uses
Used in Pharmaceutical Industry:
1-(3-Fluorophenyl)imidazoline-2-thione is used as a pharmaceutical intermediate for the development of new drugs. Its unique chemical properties and potential therapeutic effects make it a promising candidate for various pharmaceutical applications.
Used in Antimicrobial Applications:
1-(3-Fluorophenyl)imidazoline-2-thione is used as an antimicrobial agent for its potential antibacterial and antifungal properties. Its ability to inhibit the growth of certain microorganisms makes it a valuable compound in the field of medicinal chemistry, particularly for the development of new antimicrobial drugs.
Used in Industrial Applications:
1-(3-Fluorophenyl)imidazoline-2-thione is used as a corrosion inhibitor in industrial processes. Its potential to protect materials from corrosion makes it a valuable compound in various industries, such as manufacturing, construction, and oil and gas, where corrosion prevention is crucial for maintaining the integrity and longevity of equipment and structures.
Check Digit Verification of cas no
The CAS Registry Mumber 17452-26-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,7,4,5 and 2 respectively; the second part has 2 digits, 2 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 17452-26:
(7*1)+(6*7)+(5*4)+(4*5)+(3*2)+(2*2)+(1*6)=105
105 % 10 = 5
So 17452-26-5 is a valid CAS Registry Number.
InChI:InChI=1/C9H7FN2S/c10-7-2-1-3-8(6-7)12-5-4-11-9(12)13/h1-6H,(H,11,13)
