17452-31-2 Usage
Uses
Used in Pharmaceutical Industry:
5-(4-CHLOROPHENYL)-1-METHYL-1H-IMIDAZOLE-2-THIOL is used as a potential anti-cancer agent for its ability to target and inhibit the growth of cancer cells. Its specific mechanism of action and potential synergistic effects with other chemotherapeutic drugs are areas of ongoing research.
Used in Enzyme Inhibition:
In the field of biochemistry, 5-(4-CHLOROPHENYL)-1-METHYL-1H-IMIDAZOLE-2-THIOL serves as an enzyme inhibitor, potentially modulating biological processes by interfering with the activity of specific enzymes. Its inhibitory effects are under investigation to determine its applicability in treating various conditions.
Used in Antifungal Treatments:
5-(4-CHLOROPHENYL)-1-METHYL-1H-IMIDAZOLE-2-THIOL is considered for use in antifungal applications, given its potential to combat fungal infections. 5-(4-CHLOROPHENYL)-1-METHYL-1H-IMIDAZOLE-2-THIOL's effectiveness against various fungal strains and its role in treating infections are subjects of ongoing studies.
Note: The uses listed are based on the potential applications derived from the provided materials. The actual applications may vary depending on further research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 17452-31-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,7,4,5 and 2 respectively; the second part has 2 digits, 3 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 17452-31:
(7*1)+(6*7)+(5*4)+(4*5)+(3*2)+(2*3)+(1*1)=102
102 % 10 = 2
So 17452-31-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H9ClN2S/c1-13-9(6-12-10(13)14)7-2-4-8(11)5-3-7/h2-6H,1H3,(H,12,14)
