174645-81-9 Usage
Uses
Used in Chemical Synthesis:
1-Butyl-3-methylimidazolium hexafluoroan is used as a catalyst in various organic reactions, enhancing the efficiency and selectivity of the processes due to its unique chemical properties.
Used in Electrochemistry:
This ionic liquid is utilized as an additive in electrochemistry, where it contributes to improving the performance of electrochemical systems, such as batteries and fuel cells, by enhancing their stability and conductivity.
Used in Pharmaceutical and Medicinal Applications:
1-Butyl-3-methylimidazolium hexafluoroan is being studied for its potential in pharmaceutical and medicinal applications, leveraging its unique properties to develop new drugs or improve drug delivery systems.
Used in Industrial Applications:
As a solvent and electrolyte, 1-Butyl-3-methylimidazolium hexafluoroan is employed across various industries for its ability to dissolve a wide range of substances and support electrochemical processes, making it a versatile component in the development of new technologies and products.
Check Digit Verification of cas no
The CAS Registry Mumber 174645-81-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,4,6,4 and 5 respectively; the second part has 2 digits, 8 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 174645-81:
(8*1)+(7*7)+(6*4)+(5*6)+(4*4)+(3*5)+(2*8)+(1*1)=159
159 % 10 = 9
So 174645-81-9 is a valid CAS Registry Number.
InChI:InChI=1/C8H15N2.6FH.Sb/c1-3-4-5-10-7-6-9(2)8-10;;;;;;;/h6-8H,3-5H2,1-2H3;6*1H;/q+1;;;;;;;+5/p-6/rC8H15N2.F5Sb.FH/c1-3-4-5-10-7-6-9(2)8-10;1-6(2,3,4)5;/h6-8H,3-5H2,1-2H3;;1H/q+1;;/p-1
