174842-34-3 Usage
General Description
ETHYL 4-(4-METHOXYPHENOXY)-1,3-DIMETHYL-1H-PYRAZOLO[3,4-B]PYRIDINE-5-CARBOXYLATE is a chemical compound with a complex molecular structure. It is composed of ethyl, methoxyphenyl, dimethyl, pyrazolo, and pyridine groups, all connected by carboxylate linkages. ETHYL 4-(4-METHOXYPHENOXY)-1,3-DIMETHYL-1H-PYRAZOLO[3,4-B]PYRIDINE-5-CARBOXYLATE is a pyrazole derivative and belongs to the class of pyridinecarboxylate esters. It may have potential applications in the field of pharmaceuticals or organic synthesis due to its unique structure and properties. Additionally, it may have biological activity or therapeutic potential that warrants further study and investigation.
Check Digit Verification of cas no
The CAS Registry Mumber 174842-34-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,4,8,4 and 2 respectively; the second part has 2 digits, 3 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 174842-34:
(8*1)+(7*7)+(6*4)+(5*8)+(4*4)+(3*2)+(2*3)+(1*4)=153
153 % 10 = 3
So 174842-34-3 is a valid CAS Registry Number.
InChI:InChI=1/C18H19N3O4/c1-5-24-18(22)14-10-19-17-15(11(2)20-21(17)3)16(14)25-13-8-6-12(23-4)7-9-13/h6-10H,5H2,1-4H3