174842-34-3 Usage
Uses
Used in Pharmaceutical Industry:
ETHYL 4-(4-METHOXYPHENOXY)-1,3-DIMETHYL-1H-PYRAZOLO[3,4-B]PYRIDINE-5-CARBOXYLATE is used as a potential pharmaceutical agent due to its unique molecular structure and properties. Its complex arrangement of functional groups may offer opportunities for the development of new drugs with specific therapeutic targets.
Used in Organic Synthesis:
In the field of organic synthesis, ETHYL 4-(4-METHOXYPHENOXY)-1,3-DIMETHYL-1H-PYRAZOLO[3,4-B]PYRIDINE-5-CARBOXYLATE serves as a valuable intermediate or building block for the creation of more complex organic molecules. Its versatile structure allows for further functionalization and the synthesis of novel compounds with potential applications in various industries.
Used in Biological Research:
ETHYL 4-(4-METHOXYPHENOXY)-1,3-DIMETHYL-1H-PYRAZOLO[3,4-B]PYRIDINE-5-CARBOXYLATE is used as a subject of biological research to explore its potential biological activity and therapeutic potential. Further study and investigation are required to understand its interactions with biological systems and its possible use in medicine.
Check Digit Verification of cas no
The CAS Registry Mumber 174842-34-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,4,8,4 and 2 respectively; the second part has 2 digits, 3 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 174842-34:
(8*1)+(7*7)+(6*4)+(5*8)+(4*4)+(3*2)+(2*3)+(1*4)=153
153 % 10 = 3
So 174842-34-3 is a valid CAS Registry Number.
InChI:InChI=1/C18H19N3O4/c1-5-24-18(22)14-10-19-17-15(11(2)20-21(17)3)16(14)25-13-8-6-12(23-4)7-9-13/h6-10H,5H2,1-4H3