1750-46-5 Usage
Uses
Used in Pharmaceutical Industry:
2-Amino-5-chlorobenzoxazol-6-ol is used as a key intermediate in the synthesis of various drugs, contributing to the development of new pharmaceuticals with potential therapeutic applications. Its unique structure allows for the creation of compounds with specific biological activities, making it an essential component in medicinal chemistry.
Used in Agrochemical Industry:
In the agrochemical sector, 2-Amino-5-chlorobenzoxazol-6-ol is employed as a precursor in the production of agrochemical products. Its antimicrobial properties make it a candidate for use in developing pesticides and other agricultural chemicals aimed at controlling pests and diseases in crops.
Used in Antimicrobial Applications:
2-Amino-5-chlorobenzoxazol-6-ol is utilized as an antimicrobial agent due to its ability to inhibit the growth of various microorganisms. This property makes it suitable for applications in healthcare and other industries where controlling microbial growth is crucial.
Used in Anticancer Research:
2-Amino-5-chlorobenzoxazol-6-ol is also studied for its potential anticancer properties, making it a subject of interest in oncology research. Its ability to target and affect cancer cells could lead to the development of new cancer treatments.
Used in Chemical Synthesis:
Beyond its direct applications, 2-Amino-5-chlorobenzoxazol-6-ol serves as a versatile building block in organic synthesis. Its reactivity and structural features make it a valuable component in the creation of a wide range of chemical compounds for various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 1750-46-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,7,5 and 0 respectively; the second part has 2 digits, 4 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 1750-46:
(6*1)+(5*7)+(4*5)+(3*0)+(2*4)+(1*6)=75
75 % 10 = 5
So 1750-46-5 is a valid CAS Registry Number.
InChI:InChI=1/C7H5ClN2O2/c8-3-1-4-6(2-5(3)11)12-7(9)10-4/h1-2,11H,(H2,9,10)
