17511-21-6 Usage
General Description
5-Chloro-quinazoline-2,4-diamine is a chemical compound with the molecular formula C8H7ClN4. It is a type of quinazoline derivative, which is known for its potential medicinal applications. The compound has been studied for its potential use as an anticancer agent, particularly in the treatment of leukemia and other forms of cancer. It may also have applications in the development of new drugs for other diseases, due to its ability to inhibit certain enzymes and biological processes. Additionally, 5-Chloro-quinazoline-2,4-diamine has been investigated for its potential as a precursor for the synthesis of other pharmaceutical compounds. Overall, this chemical shows promise for various medical and pharmaceutical applications, and continues to be the subject of ongoing research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 17511-21-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,7,5,1 and 1 respectively; the second part has 2 digits, 2 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 17511-21:
(7*1)+(6*7)+(5*5)+(4*1)+(3*1)+(2*2)+(1*1)=86
86 % 10 = 6
So 17511-21-6 is a valid CAS Registry Number.
InChI:InChI=1/C8H7ClN4/c9-4-2-1-3-5-6(4)7(10)13-8(11)12-5/h1-3H,(H4,10,11,12,13)
