175135-10-1 Usage
General Description
2-Amino-3,5-dibromo-6-fluorobenzoic acid is a chemical compound with the molecular formula C7H4Br2FNO2. It is a derivative of benzoic acid, and it contains two bromine atoms and one fluorine atom attached to a benzene ring. The compound also has an amino group and a carboxylic acid group, making it both an amine and a carboxylic acid. 2-AMINO-3,5-DIBROMO-6-FLUOROBENZOIC ACID is commonly used in organic synthesis and medicinal chemistry as a building block for the creation of novel compounds and pharmaceuticals. Its unique structure and properties make it a valuable tool for chemical research and drug development.
Check Digit Verification of cas no
The CAS Registry Mumber 175135-10-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,1,3 and 5 respectively; the second part has 2 digits, 1 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 175135-10:
(8*1)+(7*7)+(6*5)+(5*1)+(4*3)+(3*5)+(2*1)+(1*0)=121
121 % 10 = 1
So 175135-10-1 is a valid CAS Registry Number.
InChI:InChI=1/C7H4Br2FNO2/c8-2-1-3(9)6(11)4(5(2)10)7(12)13/h1H,11H2,(H,12,13)