175135-11-2 Usage
Uses
Used in Chemical Synthesis:
2,6-DIBROMO-4-CYCLOHEXYLANILINE is used as an intermediate in the synthesis of organic compounds for its ability to participate in various chemical reactions, contributing to the formation of new molecules with desired properties.
Used in Pharmaceutical Applications:
In the pharmaceutical industry, 2,6-DIBROMO-4-CYCLOHEXYLANILINE is utilized as a reagent in chemical reactions that facilitate the development of new drugs, taking advantage of its unique molecular structure and reactivity.
Used in Medicinal Chemistry:
2,6-DIBROMO-4-CYCLOHEXYLANILINE is employed in medicinal chemistry for its potential biological activity, which is being studied to understand its implications in drug discovery and the creation of therapeutic agents.
Used in Research and Development:
2,6-DIBROMO-4-CYCLOHEXYLANILINE is also used in research and development settings to explore its properties and applications further, with the aim of expanding its use in various chemical and pharmaceutical processes.
Check Digit Verification of cas no
The CAS Registry Mumber 175135-11-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,1,3 and 5 respectively; the second part has 2 digits, 1 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 175135-11:
(8*1)+(7*7)+(6*5)+(5*1)+(4*3)+(3*5)+(2*1)+(1*1)=122
122 % 10 = 2
So 175135-11-2 is a valid CAS Registry Number.
InChI:InChI=1/C12H15Br2N/c13-10-6-9(7-11(14)12(10)15)8-4-2-1-3-5-8/h6-8H,1-5,15H2
Xn:Harmful;
