175135-46-3 Usage
Uses
Used in Pharmaceutical Industry:
4,5-Dichloro-2-(2-fluorobenzyl)pyridazine-3(2H)-one is used as a precursor in medicinal chemistry for the development of new drugs. Its distinctive molecular structure and the biological activities it demonstrates make it a promising candidate for further research and potential applications in drug discovery and design.
Used in Drug Discovery:
4,5-Dichloro-2-(2-fluorobenzyl)pyridazine-3(2H)-one is utilized as a key intermediate in the synthesis of pharmaceutical compounds. Its unique properties allow it to be a versatile building block in the creation of novel therapeutic agents with potential applications in treating various diseases and conditions.
Used in Drug Design:
4,5-Dichloro-2-(2-fluorobenzyl)pyridazine-3(2H)-one is employed as a structural component in the design of innovative drugs. Its incorporation into drug molecules can enhance their pharmacological properties, such as potency, selectivity, and bioavailability, leading to more effective treatments for patients.
Check Digit Verification of cas no
The CAS Registry Mumber 175135-46-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,1,3 and 5 respectively; the second part has 2 digits, 4 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 175135-46:
(8*1)+(7*7)+(6*5)+(5*1)+(4*3)+(3*5)+(2*4)+(1*6)=133
133 % 10 = 3
So 175135-46-3 is a valid CAS Registry Number.
InChI:InChI=1/C11H7Cl2FN2O/c12-8-5-15-16(11(17)10(8)13)6-7-3-1-2-4-9(7)14/h1-5H,6H2
