175135-50-9 Usage
Uses
Used in Pharmaceutical Industry:
2-[(2-CHLORO-3-PYRIDYL)OXY]-3-NITROPYRIDINE is used as an intermediate in the synthesis of pharmaceuticals for its potential biological activity. Its reactivity and unique structure contribute to the development of new drugs with therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical industry, 2-[(2-CHLORO-3-PYRIDYL)OXY]-3-NITROPYRIDINE serves as an intermediate in the synthesis of agrochemicals. Its reactive nature allows for the creation of compounds that can be used in various agricultural applications, such as pesticides and herbicides, to improve crop protection and yield.
Used in Organic Synthesis:
2-[(2-CHLORO-3-PYRIDYL)OXY]-3-NITROPYRIDINE is utilized in organic synthesis for its ability to participate in a variety of chemical reactions. Its chloro and nitro groups make it a versatile building block for the creation of new organic compounds with potential applications in various fields, including materials science, chemical research, and specialty chemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 175135-50-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,1,3 and 5 respectively; the second part has 2 digits, 5 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 175135-50:
(8*1)+(7*7)+(6*5)+(5*1)+(4*3)+(3*5)+(2*5)+(1*0)=129
129 % 10 = 9
So 175135-50-9 is a valid CAS Registry Number.
InChI:InChI=1/C10H6ClN3O3/c11-9-8(4-2-5-12-9)17-10-7(14(15)16)3-1-6-13-10/h1-6H
