175135-51-0 Usage
Description
2-[(5-chloro-3-pyridyl)oxy]-3-nitropyridine is a nitro-pyridine derivative with the molecular formula C10H6ClN3O3. It features a pyridine ring with a nitro group and a chloro-substituted pyridyl oxide group attached to it. This chemical compound is known for its unique chemical structure and reactivity, making it a valuable building block in organic chemistry.
Uses
Used in Pharmaceutical Synthesis:
2-[(5-chloro-3-pyridyl)oxy]-3-nitropyridine is used as a building block in the synthesis of pharmaceuticals for its potential to contribute to the development of new drugs. Its unique structure allows for the creation of various medicinal compounds with specific therapeutic properties.
Used in Agrochemical Synthesis:
In the agrochemical industry, 2-[(5-chloro-3-pyridyl)oxy]-3-nitropyridine serves as a key component in the synthesis of agrochemicals. Its incorporation into these products can enhance their effectiveness in agricultural applications, such as pest control and crop protection.
Used in Organic Chemistry Research:
2-[(5-chloro-3-pyridyl)oxy]-3-nitropyridine is utilized as a research compound in organic chemistry to explore its reactivity and potential applications in the creation of new chemical products. Its unique structure provides opportunities for further investigation and development in the field of chemistry.
It is crucial to handle 2-[(5-chloro-3-pyridyl)oxy]-3-nitropyridine with care and adhere to proper safety protocols to minimize health and environmental hazards associated with its use.
Check Digit Verification of cas no
The CAS Registry Mumber 175135-51-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,1,3 and 5 respectively; the second part has 2 digits, 5 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 175135-51:
(8*1)+(7*7)+(6*5)+(5*1)+(4*3)+(3*5)+(2*5)+(1*1)=130
130 % 10 = 0
So 175135-51-0 is a valid CAS Registry Number.
InChI:InChI=1/C10H6ClN3O3/c11-7-4-8(6-12-5-7)17-10-9(14(15)16)2-1-3-13-10/h1-6H